About 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole
4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole (PubChem CID 69076811) has the molecular formula C8H7FN2S
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole |
| PubChem CID | 69076811 |
| Molecular Formula | C8H7FN2S |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole |
| SMILES | FC1NC=CC=C1c1cscn1 |
| InChI | InChI=1S/C8H7FN2S/c9-8-6(2-1-3-10-8)7-4-12-5-11-7/h1-5,8,10H |
| InChIKey | BSGPXRADCHJWJO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole?
The IUPAC name of 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole (CID 69076811) is 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole.
What is the SMILES notation for 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole?
The canonical SMILES for 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole is FC1NC=CC=C1c1cscn1.
What is the InChIKey of 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole?
The InChIKey is BSGPXRADCHJWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN2S/c9-8-6(2-1-3-10-8)7-4-12-5-11-7/h1-5,8,10H.
What are the key properties of 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole?
4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole has a molecular weight of 182.22 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluoro-1,2-dihydropyridin-3-yl)-1,3-thiazole is sourced from PubChem (CID 69076811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).