C9H6F3NO3 — CID 69077757
(E)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enoic acid (PubChem CID 69077757) has the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. Its IUPAC name is (E)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69077757 |
| Molecular Formula | C9H6F3NO3 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | (E)-3-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(C(F)(F)F)c[nH]c1=O |
| InChI | InChI=1S/C9H6F3NO3/c10-9(11,12)6-3-5(1-2-7(14)15)8(16)13-4-6/h1-4H,(H,13,16)(H,14,15)/b2-1+ |
| InChIKey | DIEUQVCRJRZSJD-OWOJBTEDSA-N |
| XLogP | 1.49 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|