C25H27N3O6 — CID 69077898
3-O-(4-nitrophenyl) 5-O-propan-2-yl 1,1-dimethyl-2,4,5,6-tetrahydroazepino[4,5-b]indole-3,5-dicarboxylate (PubChem CID 69077898) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is 3-O-(4-nitrophenyl) 5-O-propan-2-yl 1,1-dimethyl-2,4,5,6-tetrahydroazepino[4,5-b]indole-3,5-dicarboxylate.
| Compound Name | 3-O-(4-nitrophenyl) 5-O-propan-2-yl 1,1-dimethyl-2,4,5,6-tetrahydroazepino[4,5-b]indole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 69077898 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 3-O-(4-nitrophenyl) 5-O-propan-2-yl 1,1-dimethyl-2,4,5,6-tetrahydroazepino[4,5-b]indole-3,5-dicarboxylate |
| SMILES | CC(C)OC(=O)C1CN(C(=O)Oc2ccc([N+](=O)[O-])cc2)CC(C)(C)c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C25H27N3O6/c1-15(2)33-23(29)19-13-27(24(30)34-17-11-9-16(10-12-17)28(31)32)14-25(3,4)21-18-7-5-6-8-20(18)26-22(19)21/h5-12,15,19,26H,13-14H2,1-4H3 |
| InChIKey | UMUUIZRHGVCWCJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|