C27H34Cl2N4O2SSi — CID 69078066
3-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazol-5-yl]-2-cyano-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]prop-2-enamide (PubChem CID 69078066) has the molecular formula C27H34Cl2N4O2SSi and a molecular weight of 577.65 g/mol. Its IUPAC name is 3-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazol-5-yl]-2-cyano-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]prop-2-enamide.
| Compound Name | 3-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazol-5-yl]-2-cyano-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 69078066 |
| Molecular Formula | C27H34Cl2N4O2SSi |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 576.15 |
| IUPAC Name | 3-[2-[3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazol-5-yl]-2-cyano-N-cyclopropyl-N-[(2,3-dichlorophenyl)methyl]prop-2-enamide |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCN(c2ncc(C=C(C#N)C(=O)N(Cc3cccc(Cl)c3Cl)C3CC3)s2)C1 |
| InChI | InChI=1S/C27H34Cl2N4O2SSi/c1-27(2,3)37(4,5)35-21-11-12-32(17-21)26-31-15-22(36-26)13-19(14-30)25(34)33(20-9-10-20)16-18-7-6-8-23(28)24(18)29/h6-8,13,15,20-21H,9-12,16-17H2,1-5H3 |
| InChIKey | GNCHQMQMEWBLBN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|