About (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine
(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine (PubChem CID 69078729) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine.
Molecular Properties
| Compound Name | (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine |
| PubChem CID | 69078729 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine |
| SMILES | [H]/N=C/N1CC=C(C)CC1 |
| InChI | InChI=1S/C7H12N2/c1-7-2-4-9(6-8)5-3-7/h2,6,8H,3-5H2,1H3/b8-6+ |
| InChIKey | QMJBRKTYCZVIFT-SOFGYWHQSA-N |
| XLogP | 1.25 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
The IUPAC name of (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine (CID 69078729) is (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine.
What is the SMILES notation for (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
The canonical SMILES for (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine is [H]/N=C/N1CC=C(C)CC1.
What is the InChIKey of (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
The InChIKey is QMJBRKTYCZVIFT-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H12N2/c1-7-2-4-9(6-8)5-3-7/h2,6,8H,3-5H2,1H3/b8-6+.
What are the key properties of (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine?
(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine has a molecular weight of 124.19 g/mol, XLogP of 1.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanimine is sourced from PubChem (CID 69078729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).