C17H16Cl2N2O4 — CID 69078952
2-[[4-[(3-amino-5-methylphenyl)methoxy]-3,5-dichlorobenzoyl]amino]acetic acid (PubChem CID 69078952) has the molecular formula C17H16Cl2N2O4 and a molecular weight of 383.23 g/mol. Its IUPAC name is 2-[[4-[(3-amino-5-methylphenyl)methoxy]-3,5-dichlorobenzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[(3-amino-5-methylphenyl)methoxy]-3,5-dichlorobenzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 69078952 |
| Molecular Formula | C17H16Cl2N2O4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-[[4-[(3-amino-5-methylphenyl)methoxy]-3,5-dichlorobenzoyl]amino]acetic acid |
| SMILES | Cc1cc(N)cc(COc2c(Cl)cc(C(=O)NCC(=O)O)cc2Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O4/c1-9-2-10(4-12(20)3-9)8-25-16-13(18)5-11(6-14(16)19)17(24)21-7-15(22)23/h2-6H,7-8,20H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | BLTWJBIPXPUJKY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|