About 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one
4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one (PubChem CID 69079143) has the molecular formula C22H25NO3
and a molecular weight of 351.45 g/mol. Its IUPAC name is 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one |
| PubChem CID | 69079143 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one |
| SMILES | C=Cc1ccc(O)cc1.C=Cc1ccc(OC(C)N2CCCC2=O)cc1 |
| InChI | InChI=1S/C14H17NO2.C8H8O/c1-3-12-6-8-13(9-7-12)17-11(2)15-10-4-5-14(15)16;1-2-7-3-5-8(9)6-4-7/h3,6-9,11H,1,4-5,10H2,2H3;2-6,9H,1H2 |
| InChIKey | LPIOXKFGRYAOGM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one?
The IUPAC name of 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one (CID 69079143) is 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one.
What is the SMILES notation for 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one?
The canonical SMILES for 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one is C=Cc1ccc(O)cc1.C=Cc1ccc(OC(C)N2CCCC2=O)cc1.
What is the InChIKey of 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one?
The InChIKey is LPIOXKFGRYAOGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2.C8H8O/c1-3-12-6-8-13(9-7-12)17-11(2)15-10-4-5-14(15)16;1-2-7-3-5-8(9)6-4-7/h3,6-9,11H,1,4-5,10H2,2H3;2-6,9H,1H2.
What are the key properties of 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one?
4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one has a molecular weight of 351.45 g/mol, XLogP of 4.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylphenol;1-[1-(4-ethenylphenoxy)ethyl]pyrrolidin-2-one is sourced from PubChem (CID 69079143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).