About benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate
benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate (PubChem CID 69079844) has the molecular formula C12H10BrNO5
and a molecular weight of 328.12 g/mol. Its IUPAC name is benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate.
Molecular Properties
| Compound Name | benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate |
| PubChem CID | 69079844 |
| Molecular Formula | C12H10BrNO5 |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate |
| SMILES | O=C1CC(Br)(OC(=O)OCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C12H10BrNO5/c13-12(6-9(15)14-10(12)16)19-11(17)18-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,15,16) |
| InChIKey | UYRSLIRGGACFTK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate?
The IUPAC name of benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate (CID 69079844) is benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate.
What is the SMILES notation for benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate?
The canonical SMILES for benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate is O=C1CC(Br)(OC(=O)OCc2ccccc2)C(=O)N1.
What is the InChIKey of benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate?
The InChIKey is UYRSLIRGGACFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNO5/c13-12(6-9(15)14-10(12)16)19-11(17)18-7-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,14,15,16).
What are the key properties of benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate?
benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate has a molecular weight of 328.12 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (3-bromo-2,5-dioxopyrrolidin-3-yl) carbonate is sourced from PubChem (CID 69079844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).