C16H26N2O2 — CID 69080435
tert-butyl N-[(3-amino-5-methylphenyl)methyl]-N-propan-2-ylcarbamate (PubChem CID 69080435) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is tert-butyl N-[(3-amino-5-methylphenyl)methyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[(3-amino-5-methylphenyl)methyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 69080435 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | tert-butyl N-[(3-amino-5-methylphenyl)methyl]-N-propan-2-ylcarbamate |
| SMILES | Cc1cc(N)cc(CN(C(=O)OC(C)(C)C)C(C)C)c1 |
| InChI | InChI=1S/C16H26N2O2/c1-11(2)18(15(19)20-16(4,5)6)10-13-7-12(3)8-14(17)9-13/h7-9,11H,10,17H2,1-6H3 |
| InChIKey | IKTWNVJEJCFEMR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|