methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate

C21H23NO4 — CID 69081739

IUPACmethyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate
SMILESCOC(=O)c1ccc(-c2ccc3c(c2)COC(C2CCNCC2)O3)cc1
InChIInChI=1S/C21H23NO4/c1-24-20(23)15-4-2-14(3-5-15)17-6-7-19-18(12-17)13-25-21(26-19)16-8-10-22-11-9-16/h2-7,12,16,21-22H,8-11,13H2,1H3
InChIKeyWIAZRJCMIDCQLC-UHFFFAOYSA-N
MW353.42 g/mol
LogP3.37
Rot. Bonds3

About methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate

methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate (PubChem CID 69081739) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate.

Molecular Properties

Compound Namemethyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate
PubChem CID69081739
Molecular FormulaC21H23NO4
Molecular Weight353.42 g/mol
Exact Mass353.16
IUPAC Namemethyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate
SMILESCOC(=O)c1ccc(-c2ccc3c(c2)COC(C2CCNCC2)O3)cc1
InChIInChI=1S/C21H23NO4/c1-24-20(23)15-4-2-14(3-5-15)17-6-7-19-18(12-17)13-25-21(26-19)16-8-10-22-11-9-16/h2-7,12,16,21-22H,8-11,13H2,1H3
InChIKeyWIAZRJCMIDCQLC-UHFFFAOYSA-N
XLogP3.37
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.42
LogP ≤ 53.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate?
The IUPAC name of methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate (CID 69081739) is methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate.
What is the SMILES notation for methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate?
The canonical SMILES for methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate is COC(=O)c1ccc(-c2ccc3c(c2)COC(C2CCNCC2)O3)cc1.
What is the InChIKey of methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate?
The InChIKey is WIAZRJCMIDCQLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c1-24-20(23)15-4-2-14(3-5-15)17-6-7-19-18(12-17)13-25-21(26-19)16-8-10-22-11-9-16/h2-7,12,16,21-22H,8-11,13H2,1H3.
What are the key properties of methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate?
methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate has a molecular weight of 353.42 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate is sourced from PubChem (CID 69081739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).