C21H23NO4 — CID 69081739
methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate (PubChem CID 69081739) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate.
| Compound Name | methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate |
|---|---|
| PubChem CID | 69081739 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl 4-(2-piperidin-4-yl-4H-1,3-benzodioxin-6-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc3c(c2)COC(C2CCNCC2)O3)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-24-20(23)15-4-2-14(3-5-15)17-6-7-19-18(12-17)13-25-21(26-19)16-8-10-22-11-9-16/h2-7,12,16,21-22H,8-11,13H2,1H3 |
| InChIKey | WIAZRJCMIDCQLC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |