C18H18ClN3O4 — CID 69081749
7-chloro-6-[(2,5-dimethylpyrrol-1-yl)amino]-1-ethyl-2,4-dioxoquinoline-3-carboxylic acid (PubChem CID 69081749) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is 7-chloro-6-[(2,5-dimethylpyrrol-1-yl)amino]-1-ethyl-2,4-dioxoquinoline-3-carboxylic acid.
| Compound Name | 7-chloro-6-[(2,5-dimethylpyrrol-1-yl)amino]-1-ethyl-2,4-dioxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 69081749 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 7-chloro-6-[(2,5-dimethylpyrrol-1-yl)amino]-1-ethyl-2,4-dioxoquinoline-3-carboxylic acid |
| SMILES | CCN1C(=O)C(C(=O)O)C(=O)c2cc(Nn3c(C)ccc3C)c(Cl)cc21 |
| InChI | InChI=1S/C18H18ClN3O4/c1-4-21-14-8-12(19)13(20-22-9(2)5-6-10(22)3)7-11(14)16(23)15(17(21)24)18(25)26/h5-8,15,20H,4H2,1-3H3,(H,25,26) |
| InChIKey | NRGVPLUDFPQRAU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|