C20H18Cl2F3NO4 — CID 69082451
(3S,5S)-3-chloro-5-(3-chloro-2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one (PubChem CID 69082451) has the molecular formula C20H18Cl2F3NO4 and a molecular weight of 464.27 g/mol. Its IUPAC name is (3S,5S)-3-chloro-5-(3-chloro-2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | (3S,5S)-3-chloro-5-(3-chloro-2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 69082451 |
| Molecular Formula | C20H18Cl2F3NO4 |
| Molecular Weight | 464.27 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | (3S,5S)-3-chloro-5-(3-chloro-2,6-dimethoxyphenyl)-1-[[4-(trifluoromethoxy)phenyl]methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(Cl)c(OC)c1[C@@H]1C[C@H](Cl)C(=O)N1Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18Cl2F3NO4/c1-28-16-8-7-13(21)18(29-2)17(16)15-9-14(22)19(27)26(15)10-11-3-5-12(6-4-11)30-20(23,24)25/h3-8,14-15H,9-10H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | JMGBMLLNIXUHAH-GJZGRUSLSA-N |
| XLogP | 5.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|