C23H20FNO5 — CID 69082594
4-[(4-fluorophenyl)methoxy]-1-[2-(methoxymethoxymethyl)-1-benzofuran-5-yl]pyridin-2-one (PubChem CID 69082594) has the molecular formula C23H20FNO5 and a molecular weight of 409.41 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methoxy]-1-[2-(methoxymethoxymethyl)-1-benzofuran-5-yl]pyridin-2-one.
| Compound Name | 4-[(4-fluorophenyl)methoxy]-1-[2-(methoxymethoxymethyl)-1-benzofuran-5-yl]pyridin-2-one |
|---|---|
| PubChem CID | 69082594 |
| Molecular Formula | C23H20FNO5 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-[(4-fluorophenyl)methoxy]-1-[2-(methoxymethoxymethyl)-1-benzofuran-5-yl]pyridin-2-one |
| SMILES | COCOCc1cc2cc(-n3ccc(OCc4ccc(F)cc4)cc3=O)ccc2o1 |
| InChI | InChI=1S/C23H20FNO5/c1-27-15-28-14-21-11-17-10-19(6-7-22(17)30-21)25-9-8-20(12-23(25)26)29-13-16-2-4-18(24)5-3-16/h2-12H,13-15H2,1H3 |
| InChIKey | DTGGVNDSEVEDTD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|