About 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one
6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one (PubChem CID 69082926) has the molecular formula C27H26N2O3
and a molecular weight of 426.52 g/mol. Its IUPAC name is 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one.
Molecular Properties
| Compound Name | 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one |
| PubChem CID | 69082926 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one |
| SMILES | COc1ccc2nc(C)oc2c1C1CCCC(=O)N1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H26N2O3/c1-18-28-22-14-15-24(31-2)26(27(22)32-18)23-12-7-13-25(30)29(23)17-19-8-6-11-21(16-19)20-9-4-3-5-10-20/h3-6,8-11,14-16,23H,7,12-13,17H2,1-2H3 |
| InChIKey | OESUYCBPTZMHEI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one?
The IUPAC name of 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one (CID 69082926) is 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one.
What is the SMILES notation for 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one?
The canonical SMILES for 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one is COc1ccc2nc(C)oc2c1C1CCCC(=O)N1Cc1cccc(-c2ccccc2)c1.
What is the InChIKey of 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one?
The InChIKey is OESUYCBPTZMHEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26N2O3/c1-18-28-22-14-15-24(31-2)26(27(22)32-18)23-12-7-13-25(30)29(23)17-19-8-6-11-21(16-19)20-9-4-3-5-10-20/h3-6,8-11,14-16,23H,7,12-13,17H2,1-2H3.
What are the key properties of 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one?
6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one has a molecular weight of 426.52 g/mol, XLogP of 6.07, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-methoxy-2-methyl-1,3-benzoxazol-7-yl)-1-[(3-phenylphenyl)methyl]piperidin-2-one is sourced from PubChem (CID 69082926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).