C8H12N2O3S — CID 69083611
(3aR,5R,6S,7R,7aR)-2-amino-5-ethenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 69083611) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-amino-5-ethenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-amino-5-ethenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 69083611 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-amino-5-ethenyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | C=C[C@H]1O[C@@H]2SC(N)=N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H12N2O3S/c1-2-3-5(11)6(12)4-7(13-3)14-8(9)10-4/h2-7,11-12H,1H2,(H2,9,10)/t3-,4-,5-,6-,7-/m1/s1 |
| InChIKey | NMKRQPWXOLZFFD-NYMZXIIRSA-N |
| XLogP | -0.95 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|