About (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one
(4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one (PubChem CID 69084413) has the molecular formula C20H14N4O2
and a molecular weight of 342.36 g/mol. Its IUPAC name is (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one |
| PubChem CID | 69084413 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](c2cncc(C#Cc3ccccc3)c2)[C@H](c2ccnnc2)O1 |
| InChI | InChI=1S/C20H14N4O2/c25-20-24-18(19(26-20)16-8-9-22-23-13-16)17-10-15(11-21-12-17)7-6-14-4-2-1-3-5-14/h1-5,8-13,18-19H,(H,24,25)/t18-,19-/m0/s1 |
| InChIKey | SRFPOHMMTGLSEW-OALUTQOASA-N |
| XLogP | 2.79 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one?
The IUPAC name of (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one (CID 69084413) is (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one?
The canonical SMILES for (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one is O=C1N[C@@H](c2cncc(C#Cc3ccccc3)c2)[C@H](c2ccnnc2)O1.
What is the InChIKey of (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one?
The InChIKey is SRFPOHMMTGLSEW-OALUTQOASA-N. The full InChI is InChI=1S/C20H14N4O2/c25-20-24-18(19(26-20)16-8-9-22-23-13-16)17-10-15(11-21-12-17)7-6-14-4-2-1-3-5-14/h1-5,8-13,18-19H,(H,24,25)/t18-,19-/m0/s1.
What are the key properties of (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one?
(4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one has a molecular weight of 342.36 g/mol, XLogP of 2.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-[5-(2-phenylethynyl)-3-pyridinyl]-5-pyridazin-4-yl-1,3-oxazolidin-2-one is sourced from PubChem (CID 69084413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).