C15H16ClN3O3S — CID 69084531
1-(3-chloropropyl)-3-(6-methoxy-3-pyridinyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 69084531) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 1-(3-chloropropyl)-3-(6-methoxy-3-pyridinyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 1-(3-chloropropyl)-3-(6-methoxy-3-pyridinyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 69084531 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-(3-chloropropyl)-3-(6-methoxy-3-pyridinyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | COc1ccc(N2c3ccccc3N(CCCCl)S2(=O)=O)cn1 |
| InChI | InChI=1S/C15H16ClN3O3S/c1-22-15-8-7-12(11-17-15)19-14-6-3-2-5-13(14)18(10-4-9-16)23(19,20)21/h2-3,5-8,11H,4,9-10H2,1H3 |
| InChIKey | KXVHVMVBUIABRS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|