About 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one
6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one (PubChem CID 69084595) has the molecular formula C24H24FN3O3
and a molecular weight of 421.47 g/mol. Its IUPAC name is 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one.
Molecular Properties
| Compound Name | 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one |
| PubChem CID | 69084595 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one |
| SMILES | COc1ccnc(OC)c1C1CCCC(=O)N1Cc1ccc(F)c(-c2ccccn2)c1 |
| InChI | InChI=1S/C24H24FN3O3/c1-30-21-11-13-27-24(31-2)23(21)20-7-5-8-22(29)28(20)15-16-9-10-18(25)17(14-16)19-6-3-4-12-26-19/h3-4,6,9-14,20H,5,7-8,15H2,1-2H3 |
| InChIKey | ITIAEHHNBTWJML-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one?
The IUPAC name of 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one (CID 69084595) is 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one.
What is the SMILES notation for 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one?
The canonical SMILES for 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one is COc1ccnc(OC)c1C1CCCC(=O)N1Cc1ccc(F)c(-c2ccccn2)c1.
What is the InChIKey of 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one?
The InChIKey is ITIAEHHNBTWJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24FN3O3/c1-30-21-11-13-27-24(31-2)23(21)20-7-5-8-22(29)28(20)15-16-9-10-18(25)17(14-16)19-6-3-4-12-26-19/h3-4,6,9-14,20H,5,7-8,15H2,1-2H3.
What are the key properties of 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one?
6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one has a molecular weight of 421.47 g/mol, XLogP of 4.55, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dimethoxy-3-pyridinyl)-1-[(4-fluoro-3-pyridin-2-ylphenyl)methyl]piperidin-2-one is sourced from PubChem (CID 69084595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).