C26H33FN2O5S — CID 69084882
(3aR,5S,6S,7R,7aR)-5-[(1S)-1-fluoroethyl]-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine (PubChem CID 69084882) has the molecular formula C26H33FN2O5S and a molecular weight of 504.62 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-5-[(1S)-1-fluoroethyl]-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine.
| Compound Name | (3aR,5S,6S,7R,7aR)-5-[(1S)-1-fluoroethyl]-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 69084882 |
| Molecular Formula | C26H33FN2O5S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-5-[(1S)-1-fluoroethyl]-6,7-bis[(4-methoxyphenyl)methoxy]-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
| SMILES | COc1ccc(CO[C@H]2[C@H](OCc3ccc(OC)cc3)[C@H]3N=C(N(C)C)S[C@H]3O[C@@H]2[C@H](C)F)cc1 |
| InChI | InChI=1S/C26H33FN2O5S/c1-16(27)22-24(33-15-18-8-12-20(31-5)13-9-18)23(21-25(34-22)35-26(28-21)29(2)3)32-14-17-6-10-19(30-4)11-7-17/h6-13,16,21-25H,14-15H2,1-5H3/t16-,21+,22+,23+,24+,25+/m0/s1 |
| InChIKey | NDBBRJUQAOMUAQ-JDOPJYRVSA-N |
| XLogP | 4.29 |
| TPSA | 61.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |