About [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea
[4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea (PubChem CID 69085448) has the molecular formula C15H11FN4O2
and a molecular weight of 298.28 g/mol. Its IUPAC name is [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea.
Molecular Properties
| Compound Name | [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea |
| PubChem CID | 69085448 |
| Molecular Formula | C15H11FN4O2 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea |
| SMILES | NC(=O)Nc1cc(-c2ocnc2-c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C15H11FN4O2/c16-11-3-1-9(2-4-11)13-14(22-8-19-13)10-5-6-18-12(7-10)20-15(17)21/h1-8H,(H3,17,18,20,21) |
| InChIKey | OQTWCWPFOSBVDI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea?
The IUPAC name of [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea (CID 69085448) is [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea.
What is the SMILES notation for [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea?
The canonical SMILES for [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea is NC(=O)Nc1cc(-c2ocnc2-c2ccc(F)cc2)ccn1.
What is the InChIKey of [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea?
The InChIKey is OQTWCWPFOSBVDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11FN4O2/c16-11-3-1-9(2-4-11)13-14(22-8-19-13)10-5-6-18-12(7-10)20-15(17)21/h1-8H,(H3,17,18,20,21).
What are the key properties of [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea?
[4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea has a molecular weight of 298.28 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(4-fluorophenyl)-1,3-oxazol-5-yl]-2-pyridinyl]urea is sourced from PubChem (CID 69085448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).