C10H15F3N2O5S — CID 69086195
(3aR,5S,6S,7R,7aR)-2-(2-hydroxyethylamino)-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 69086195) has the molecular formula C10H15F3N2O5S and a molecular weight of 332.30 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-(2-hydroxyethylamino)-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-(2-hydroxyethylamino)-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 69086195 |
| Molecular Formula | C10H15F3N2O5S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-(2-hydroxyethylamino)-5-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | OCCNC1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H]([C@@H](O)C(F)(F)F)O[C@@H]2S1 |
| InChI | InChI=1S/C10H15F3N2O5S/c11-10(12,13)7(19)6-5(18)4(17)3-8(20-6)21-9(15-3)14-1-2-16/h3-8,16-19H,1-2H2,(H,14,15)/t3-,4-,5+,6+,7-,8-/m1/s1 |
| InChIKey | XWPUQAWRNOKXIS-YQOPPWPCSA-N |
| XLogP | -1.59 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |