C19H24O10 — CID 69087167
(4aS,6S,8R,8aS)-6-[[(2S,3R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 69087167) has the molecular formula C19H24O10 and a molecular weight of 412.39 g/mol. Its IUPAC name is (4aS,6S,8R,8aS)-6-[[(2S,3R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aS,6S,8R,8aS)-6-[[(2S,3R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 69087167 |
| Molecular Formula | C19H24O10 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (4aS,6S,8R,8aS)-6-[[(2S,3R,5R)-3,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | OC1[C@H](O[C@@H]2C3CO[C@H](O3)C(O)[C@H]2O)O[C@H]2COC(c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C19H24O10/c20-11-13(22)18-25-7-9(26-18)16(11)29-19-14(23)12(21)15-10(27-19)6-24-17(28-15)8-4-2-1-3-5-8/h1-5,9-23H,6-7H2/t9?,10-,11+,12+,13?,14?,15+,16+,17?,18+,19-/m0/s1 |
| InChIKey | LDKPOLOLJATJTM-OGUOHYDKSA-N |
| XLogP | -1.59 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |