C35H32N6O4 — CID 69087657
tert-butyl N-[1-[4-[4-(3-nitrophenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate (PubChem CID 69087657) has the molecular formula C35H32N6O4 and a molecular weight of 600.68 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[4-(3-nitrophenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[4-(3-nitrophenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 69087657 |
| Molecular Formula | C35H32N6O4 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | tert-butyl N-[1-[4-[4-(3-nitrophenyl)-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-c3c(-c4cccc([N+](=O)[O-])c4)nc4n3-c3cccnc3Nc3ccccc3-4)cc2)CCC1 |
| InChI | InChI=1S/C35H32N6O4/c1-34(2,3)45-33(42)39-35(18-8-19-35)24-16-14-22(15-17-24)30-29(23-9-6-10-25(21-23)41(43)44)38-32-26-11-4-5-12-27(26)37-31-28(40(30)32)13-7-20-36-31/h4-7,9-17,20-21H,8,18-19H2,1-3H3,(H,36,37)(H,39,42) |
| InChIKey | MZUMIKGPHMYADL-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 124.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|