C31H31N5O3 — CID 69087664
tert-butyl N-[1-[4-(4-acetyl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamate (PubChem CID 69087664) has the molecular formula C31H31N5O3 and a molecular weight of 521.62 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(4-acetyl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(4-acetyl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 69087664 |
| Molecular Formula | C31H31N5O3 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | tert-butyl N-[1-[4-(4-acetyl-2,5,13,15-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,5,7,9,11,15,17-octaen-3-yl)phenyl]cyclobutyl]carbamate |
| SMILES | CC(=O)c1nc2n(c1-c1ccc(C3(NC(=O)OC(C)(C)C)CCC3)cc1)-c1cccnc1Nc1ccccc1-2 |
| InChI | InChI=1S/C31H31N5O3/c1-19(37)25-26(20-12-14-21(15-13-20)31(16-8-17-31)35-29(38)39-30(2,3)4)36-24-11-7-18-32-27(24)33-23-10-6-5-9-22(23)28(36)34-25/h5-7,9-15,18H,8,16-17H2,1-4H3,(H,32,33)(H,35,38) |
| InChIKey | ONMMXJRCXLERIQ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |