About (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol
(3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 69087710) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol.
Molecular Properties
| Compound Name | (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol |
| PubChem CID | 69087710 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | COC1OC=CC(O)[C@@H]1O |
| InChI | InChI=1S/C6H10O4/c1-9-6-5(8)4(7)2-3-10-6/h2-8H,1H3/t4?,5-,6?/m0/s1 |
| InChIKey | RRVMTPHITJSECJ-XRVVJQKQSA-N |
| XLogP | -0.78 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol?
The IUPAC name of (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol (CID 69087710) is (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol.
What is the SMILES notation for (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol?
The canonical SMILES for (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol is COC1OC=CC(O)[C@@H]1O.
What is the InChIKey of (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol?
The InChIKey is RRVMTPHITJSECJ-XRVVJQKQSA-N. The full InChI is InChI=1S/C6H10O4/c1-9-6-5(8)4(7)2-3-10-6/h2-8H,1H3/t4?,5-,6?/m0/s1.
What are the key properties of (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol?
(3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol has a molecular weight of 146.14 g/mol, XLogP of -0.78, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-methoxy-3,4-dihydro-2H-pyran-3,4-diol is sourced from PubChem (CID 69087710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).