C8H12ClN3O2 — CID 69087741
2-(2-chlorobutyl)-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 69087741) has the molecular formula C8H12ClN3O2 and a molecular weight of 217.66 g/mol. Its IUPAC name is 2-(2-chlorobutyl)-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(2-chlorobutyl)-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 69087741 |
| Molecular Formula | C8H12ClN3O2 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-(2-chlorobutyl)-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | CCC(Cl)Cn1ncc(=O)n(C)c1=O |
| InChI | InChI=1S/C8H12ClN3O2/c1-3-6(9)5-12-8(14)11(2)7(13)4-10-12/h4,6H,3,5H2,1-2H3 |
| InChIKey | ACEKJLSMPCKMLQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|