C19H19F2NO3 — CID 69088494
2-[(5S)-3,5-bis(3-fluorophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]ethanol (PubChem CID 69088494) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is 2-[(5S)-3,5-bis(3-fluorophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]ethanol.
| Compound Name | 2-[(5S)-3,5-bis(3-fluorophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]ethanol |
|---|---|
| PubChem CID | 69088494 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[(5S)-3,5-bis(3-fluorophenyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl]ethanol |
| SMILES | OCCC12COC(c3cccc(F)c3)N1[C@H](c1cccc(F)c1)OC2 |
| InChI | InChI=1S/C19H19F2NO3/c20-15-5-1-3-13(9-15)17-22-18(14-4-2-6-16(21)10-14)25-12-19(22,7-8-23)11-24-17/h1-6,9-10,17-18,23H,7-8,11-12H2/t17-,18?,19?/m0/s1 |
| InChIKey | MIJZXYKMFYOTKK-VIQWUECVSA-N |
| XLogP | 3.15 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |