About 5,15-dipentylporphyrin
5,15-dipentylporphyrin (PubChem CID 69088510) has the molecular formula C30H32N4
and a molecular weight of 448.61 g/mol. Its IUPAC name is 5,15-dipentylporphyrin.
Molecular Properties
| Compound Name | 5,15-dipentylporphyrin |
| PubChem CID | 69088510 |
| Molecular Formula | C30H32N4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 5,15-dipentylporphyrin |
| SMILES | CCCCC/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C(CCCCC)=C2/C=CC(=N2)/C=C2/C=CC1=N2 |
| InChI | InChI=1S/C30H32N4/c1-3-5-7-9-25-27-15-11-21(31-27)19-23-13-17-29(33-23)26(10-8-6-4-2)30-18-14-24(34-30)20-22-12-16-28(25)32-22/h11-20H,3-10H2,1-2H3/b21-19-,22-20-,23-19-,24-20-,27-25-,28-25-,29-26-,30-26- |
| InChIKey | UJGHOKRRFGXMLZ-SHYRUGGISA-N |
| XLogP | 7.48 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,15-dipentylporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,15-dipentylporphyrin?
The IUPAC name of 5,15-dipentylporphyrin (CID 69088510) is 5,15-dipentylporphyrin.
What is the SMILES notation for 5,15-dipentylporphyrin?
The canonical SMILES for 5,15-dipentylporphyrin is CCCCC/C1=C2\C=CC(=N2)/C=C2/C=CC(=N2)/C(CCCCC)=C2/C=CC(=N2)/C=C2/C=CC1=N2.
What is the InChIKey of 5,15-dipentylporphyrin?
The InChIKey is UJGHOKRRFGXMLZ-SHYRUGGISA-N. The full InChI is InChI=1S/C30H32N4/c1-3-5-7-9-25-27-15-11-21(31-27)19-23-13-17-29(33-23)26(10-8-6-4-2)30-18-14-24(34-30)20-22-12-16-28(25)32-22/h11-20H,3-10H2,1-2H3/b21-19-,22-20-,23-19-,24-20-,27-25-,28-25-,29-26-,30-26-.
What are the key properties of 5,15-dipentylporphyrin?
5,15-dipentylporphyrin has a molecular weight of 448.61 g/mol, XLogP of 7.48, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,15-dipentylporphyrin is sourced from PubChem (CID 69088510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).