C25H20N4O — CID 69088776
2-[2-(2-phenylethynyl)benzoyl]-4-piperazin-1-ylpyridine-3-carbonitrile (PubChem CID 69088776) has the molecular formula C25H20N4O and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[2-(2-phenylethynyl)benzoyl]-4-piperazin-1-ylpyridine-3-carbonitrile.
| Compound Name | 2-[2-(2-phenylethynyl)benzoyl]-4-piperazin-1-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 69088776 |
| Molecular Formula | C25H20N4O |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-[2-(2-phenylethynyl)benzoyl]-4-piperazin-1-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(N2CCNCC2)ccnc1C(=O)c1ccccc1C#Cc1ccccc1 |
| InChI | InChI=1S/C25H20N4O/c26-18-22-23(29-16-14-27-15-17-29)12-13-28-24(22)25(30)21-9-5-4-8-20(21)11-10-19-6-2-1-3-7-19/h1-9,12-13,27H,14-17H2 |
| InChIKey | WRGBGTVINFVZQN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|