About 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine
4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine (PubChem CID 69088832) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine |
| PubChem CID | 69088832 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine |
| SMILES | C1=CN(OCc2ccccc2)C2=CCNC2=C1 |
| InChI | InChI=1S/C14H14N2O/c1-2-5-12(6-3-1)11-17-16-10-4-7-13-14(16)8-9-15-13/h1-8,10,15H,9,11H2 |
| InChIKey | XLTPMCZAKATPEK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine?
The IUPAC name of 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine (CID 69088832) is 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine.
What is the SMILES notation for 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine?
The canonical SMILES for 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine is C1=CN(OCc2ccccc2)C2=CCNC2=C1.
What is the InChIKey of 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine?
The InChIKey is XLTPMCZAKATPEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O/c1-2-5-12(6-3-1)11-17-16-10-4-7-13-14(16)8-9-15-13/h1-8,10,15H,9,11H2.
What are the key properties of 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine?
4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine has a molecular weight of 226.28 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylmethoxy-1,2-dihydropyrrolo[3,2-b]pyridine is sourced from PubChem (CID 69088832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).