C6H5F3N2O — CID 69089027
2-(1,2,2-trifluoroethyl)-1H-pyrimidin-6-one (PubChem CID 69089027) has the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. Its IUPAC name is 2-(1,2,2-trifluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(1,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 69089027 |
| Molecular Formula | C6H5F3N2O |
| Molecular Weight | 178.11 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 2-(1,2,2-trifluoroethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(C(F)C(F)F)[nH]1 |
| InChI | InChI=1S/C6H5F3N2O/c7-4(5(8)9)6-10-2-1-3(12)11-6/h1-2,4-5H,(H,10,11,12) |
| InChIKey | KEWYXYSYINQHBS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.11 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |