About cobalt;porphyrin
cobalt;porphyrin (PubChem CID 69089029) has the molecular formula C20H12CoN4
and a molecular weight of 367.28 g/mol. Its IUPAC name is cobalt;porphyrin.
Molecular Properties
| Compound Name | cobalt;porphyrin |
| PubChem CID | 69089029 |
| Molecular Formula | C20H12CoN4 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | cobalt;porphyrin |
| SMILES | C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[Co] |
| InChI | InChI=1S/C20H12N4.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-; |
| InChIKey | AASDGEPFTXFDIU-QDJBTJTOSA-N |
| XLogP | 3.58 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cobalt;porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;porphyrin?
The IUPAC name of cobalt;porphyrin (CID 69089029) is cobalt;porphyrin.
What is the SMILES notation for cobalt;porphyrin?
The canonical SMILES for cobalt;porphyrin is C1=C/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C=C3.[Co].
What is the InChIKey of cobalt;porphyrin?
The InChIKey is AASDGEPFTXFDIU-QDJBTJTOSA-N. The full InChI is InChI=1S/C20H12N4.Co/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;/h1-12H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;.
What are the key properties of cobalt;porphyrin?
cobalt;porphyrin has a molecular weight of 367.28 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;porphyrin is sourced from PubChem (CID 69089029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).