About 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one
11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one (PubChem CID 69089342) has the molecular formula C16H17NO4
and a molecular weight of 287.31 g/mol. Its IUPAC name is 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one.
Molecular Properties
| Compound Name | 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one |
| PubChem CID | 69089342 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one |
| SMILES | O=C1C=COC12CCC1(CC2)OCC(c2ccccn2)O1 |
| InChI | InChI=1S/C16H17NO4/c18-14-4-10-19-15(14)5-7-16(8-6-15)20-11-13(21-16)12-3-1-2-9-17-12/h1-4,9-10,13H,5-8,11H2 |
| InChIKey | JOXXPFPALCLEGE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one?
The IUPAC name of 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one (CID 69089342) is 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one.
What is the SMILES notation for 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one?
The canonical SMILES for 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one is O=C1C=COC12CCC1(CC2)OCC(c2ccccn2)O1.
What is the InChIKey of 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one?
The InChIKey is JOXXPFPALCLEGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4/c18-14-4-10-19-15(14)5-7-16(8-6-15)20-11-13(21-16)12-3-1-2-9-17-12/h1-4,9-10,13H,5-8,11H2.
What are the key properties of 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one?
11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one has a molecular weight of 287.31 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 11-pyridin-2-yl-4,9,12-trioxadispiro[4.2.48.25]tetradec-2-en-1-one is sourced from PubChem (CID 69089342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).