C21H19IO — CID 69089919
9-iodo-7,7-dimethyl-4a,8,9,12a-tetrahydrofluoreno[4,3-b][1]benzofuran (PubChem CID 69089919) has the molecular formula C21H19IO and a molecular weight of 414.29 g/mol. Its IUPAC name is 9-iodo-7,7-dimethyl-4a,8,9,12a-tetrahydrofluoreno[4,3-b][1]benzofuran.
| Compound Name | 9-iodo-7,7-dimethyl-4a,8,9,12a-tetrahydrofluoreno[4,3-b][1]benzofuran |
|---|---|
| PubChem CID | 69089919 |
| Molecular Formula | C21H19IO |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 9-iodo-7,7-dimethyl-4a,8,9,12a-tetrahydrofluoreno[4,3-b][1]benzofuran |
| SMILES | CC1(C)C2=C(C=CC(I)C2)c2c1ccc1c2OC2C=CC=CC12 |
| InChI | InChI=1S/C21H19IO/c1-21(2)16-10-9-14-13-5-3-4-6-18(13)23-20(14)19(16)15-8-7-12(22)11-17(15)21/h3-10,12-13,18H,11H2,1-2H3 |
| InChIKey | GXJKXKNOSUVQHG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|