About 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea
1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea (PubChem CID 6909017) has the molecular formula C16H15F2N3S
and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea.
Molecular Properties
| Compound Name | 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea |
| PubChem CID | 6909017 |
| Molecular Formula | C16H15F2N3S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea |
| SMILES | Fc1ccc(/C=N/NC(=S)NCCc2ccccc2)cc1F |
| InChI | InChI=1S/C16H15F2N3S/c17-14-7-6-13(10-15(14)18)11-20-21-16(22)19-9-8-12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H2,19,21,22)/b20-11+ |
| InChIKey | IWPSAYWTXWFNIA-RGVLZGJSSA-N |
| XLogP | 3.01 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea?
The IUPAC name of 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea (CID 6909017) is 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea.
What is the SMILES notation for 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea?
The canonical SMILES for 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea is Fc1ccc(/C=N/NC(=S)NCCc2ccccc2)cc1F.
What is the InChIKey of 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea?
The InChIKey is IWPSAYWTXWFNIA-RGVLZGJSSA-N. The full InChI is InChI=1S/C16H15F2N3S/c17-14-7-6-13(10-15(14)18)11-20-21-16(22)19-9-8-12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H2,19,21,22)/b20-11+.
What are the key properties of 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea?
1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea has a molecular weight of 319.38 g/mol, XLogP of 3.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(3,4-difluorophenyl)methylideneamino]-3-(2-phenylethyl)thiourea is sourced from PubChem (CID 6909017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).