About azane;2,4-diethyl-1-methylbenzimidazole
azane;2,4-diethyl-1-methylbenzimidazole (PubChem CID 69090242) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is azane;2,4-diethyl-1-methylbenzimidazole.
Molecular Properties
| Compound Name | azane;2,4-diethyl-1-methylbenzimidazole |
| PubChem CID | 69090242 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | azane;2,4-diethyl-1-methylbenzimidazole |
| SMILES | CCc1cccc2c1nc(CC)n2C.N |
| InChI | InChI=1S/C12H16N2.H3N/c1-4-9-7-6-8-10-12(9)13-11(5-2)14(10)3;/h6-8H,4-5H2,1-3H3;1H3 |
| InChIKey | IQKBHPWNJJNTOA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;2,4-diethyl-1-methylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,4-diethyl-1-methylbenzimidazole?
The IUPAC name of azane;2,4-diethyl-1-methylbenzimidazole (CID 69090242) is azane;2,4-diethyl-1-methylbenzimidazole.
What is the SMILES notation for azane;2,4-diethyl-1-methylbenzimidazole?
The canonical SMILES for azane;2,4-diethyl-1-methylbenzimidazole is CCc1cccc2c1nc(CC)n2C.N.
What is the InChIKey of azane;2,4-diethyl-1-methylbenzimidazole?
The InChIKey is IQKBHPWNJJNTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2.H3N/c1-4-9-7-6-8-10-12(9)13-11(5-2)14(10)3;/h6-8H,4-5H2,1-3H3;1H3.
What are the key properties of azane;2,4-diethyl-1-methylbenzimidazole?
azane;2,4-diethyl-1-methylbenzimidazole has a molecular weight of 205.31 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,4-diethyl-1-methylbenzimidazole is sourced from PubChem (CID 69090242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).