About 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid
2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 69090408) has the molecular formula C9H17NO3Si
and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| PubChem CID | 69090408 |
| Molecular Formula | C9H17NO3Si |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | C[Si](C)(C)OC1CC=CCN1C(=O)O |
| InChI | InChI=1S/C9H17NO3Si/c1-14(2,3)13-8-6-4-5-7-10(8)9(11)12/h4-5,8H,6-7H2,1-3H3,(H,11,12) |
| InChIKey | KMUSZKODTCPXKU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The IUPAC name of 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid (CID 69090408) is 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid.
What is the SMILES notation for 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The canonical SMILES for 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid is C[Si](C)(C)OC1CC=CCN1C(=O)O.
What is the InChIKey of 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The InChIKey is KMUSZKODTCPXKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3Si/c1-14(2,3)13-8-6-4-5-7-10(8)9(11)12/h4-5,8H,6-7H2,1-3H3,(H,11,12).
What are the key properties of 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid?
2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid has a molecular weight of 215.32 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilyloxy-3,6-dihydro-2H-pyridine-1-carboxylic acid is sourced from PubChem (CID 69090408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).