C18H25NO3 — CID 69090577
(4R,5S)-4-methyl-3-[(2R)-2-methylheptanoyl]-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 69090577) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (4R,5S)-4-methyl-3-[(2R)-2-methylheptanoyl]-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-methyl-3-[(2R)-2-methylheptanoyl]-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69090577 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (4R,5S)-4-methyl-3-[(2R)-2-methylheptanoyl]-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@@H](C)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C18H25NO3/c1-4-5-7-10-13(2)17(20)19-14(3)16(22-18(19)21)15-11-8-6-9-12-15/h6,8-9,11-14,16H,4-5,7,10H2,1-3H3/t13-,14-,16-/m1/s1 |
| InChIKey | VOVLACFYFDVAFZ-IIAWOOMASA-N |
| XLogP | 4.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|