About 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol
4-(1,2-dihydropyridin-2-yl)piperidin-4-ol (PubChem CID 69090804) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol.
Molecular Properties
| Compound Name | 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol |
| PubChem CID | 69090804 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol |
| SMILES | OC1(C2C=CC=CN2)CCNCC1 |
| InChI | InChI=1S/C10H16N2O/c13-10(4-7-11-8-5-10)9-3-1-2-6-12-9/h1-3,6,9,11-13H,4-5,7-8H2 |
| InChIKey | NUKDLNABWFZAFL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol?
The IUPAC name of 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol (CID 69090804) is 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol.
What is the SMILES notation for 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol?
The canonical SMILES for 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol is OC1(C2C=CC=CN2)CCNCC1.
What is the InChIKey of 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol?
The InChIKey is NUKDLNABWFZAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c13-10(4-7-11-8-5-10)9-3-1-2-6-12-9/h1-3,6,9,11-13H,4-5,7-8H2.
What are the key properties of 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol?
4-(1,2-dihydropyridin-2-yl)piperidin-4-ol has a molecular weight of 180.25 g/mol, XLogP of 0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2-dihydropyridin-2-yl)piperidin-4-ol is sourced from PubChem (CID 69090804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).