C12H18O2 — CID 69091201
4,6,6,6a-tetramethyl-1,3,3a,4-tetrahydropentalene-2,5-dione (PubChem CID 69091201) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4,6,6,6a-tetramethyl-1,3,3a,4-tetrahydropentalene-2,5-dione.
| Compound Name | 4,6,6,6a-tetramethyl-1,3,3a,4-tetrahydropentalene-2,5-dione |
|---|---|
| PubChem CID | 69091201 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4,6,6,6a-tetramethyl-1,3,3a,4-tetrahydropentalene-2,5-dione |
| SMILES | CC1C(=O)C(C)(C)C2(C)CC(=O)CC12 |
| InChI | InChI=1S/C12H18O2/c1-7-9-5-8(13)6-12(9,4)11(2,3)10(7)14/h7,9H,5-6H2,1-4H3 |
| InChIKey | LQQDEFQQCSVFFU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |