C20H30N4O3 — CID 69091571
3-cyclohexyl-2-N-morpholin-4-yl-2-N-propylpyridine-2,4-dicarboxamide (PubChem CID 69091571) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-cyclohexyl-2-N-morpholin-4-yl-2-N-propylpyridine-2,4-dicarboxamide.
| Compound Name | 3-cyclohexyl-2-N-morpholin-4-yl-2-N-propylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 69091571 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 3-cyclohexyl-2-N-morpholin-4-yl-2-N-propylpyridine-2,4-dicarboxamide |
| SMILES | CCCN(C(=O)c1nccc(C(N)=O)c1C1CCCCC1)N1CCOCC1 |
| InChI | InChI=1S/C20H30N4O3/c1-2-10-24(23-11-13-27-14-12-23)20(26)18-17(15-6-4-3-5-7-15)16(19(21)25)8-9-22-18/h8-9,15H,2-7,10-14H2,1H3,(H2,21,25) |
| InChIKey | PYRDJXNYVSMBSQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |