C18H22F3N3O — CID 69091652
2-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]-3-(2,3,4-trifluorophenyl)propanamide (PubChem CID 69091652) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]-3-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 2-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]-3-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 69091652 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-[3,5-di(propan-2-yl)-1H-pyrazol-4-yl]-3-(2,3,4-trifluorophenyl)propanamide |
| SMILES | CC(C)c1n[nH]c(C(C)C)c1C(Cc1ccc(F)c(F)c1F)C(N)=O |
| InChI | InChI=1S/C18H22F3N3O/c1-8(2)16-13(17(9(3)4)24-23-16)11(18(22)25)7-10-5-6-12(19)15(21)14(10)20/h5-6,8-9,11H,7H2,1-4H3,(H2,22,25)(H,23,24) |
| InChIKey | PIKAHTDCXDRICL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|