About 1,1-dimethoxyethane;1,3-dioxolane
1,1-dimethoxyethane;1,3-dioxolane (PubChem CID 69091963) has the molecular formula C7H16O4
and a molecular weight of 164.20 g/mol. Its IUPAC name is 1,1-dimethoxyethane;1,3-dioxolane.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;1,3-dioxolane |
| PubChem CID | 69091963 |
| Molecular Formula | C7H16O4 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 1,1-dimethoxyethane;1,3-dioxolane |
| SMILES | C1COCO1.COC(C)OC |
| InChI | InChI=1S/C4H10O2.C3H6O2/c1-4(5-2)6-3;1-2-5-3-4-1/h4H,1-3H3;1-3H2 |
| InChIKey | ZYIHXDFXGKJZLG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;1,3-dioxolane?
The IUPAC name of 1,1-dimethoxyethane;1,3-dioxolane (CID 69091963) is 1,1-dimethoxyethane;1,3-dioxolane.
What is the SMILES notation for 1,1-dimethoxyethane;1,3-dioxolane?
The canonical SMILES for 1,1-dimethoxyethane;1,3-dioxolane is C1COCO1.COC(C)OC.
What is the InChIKey of 1,1-dimethoxyethane;1,3-dioxolane?
The InChIKey is ZYIHXDFXGKJZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C3H6O2/c1-4(5-2)6-3;1-2-5-3-4-1/h4H,1-3H3;1-3H2.
What are the key properties of 1,1-dimethoxyethane;1,3-dioxolane?
1,1-dimethoxyethane;1,3-dioxolane has a molecular weight of 164.20 g/mol, XLogP of 0.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;1,3-dioxolane is sourced from PubChem (CID 69091963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).