C29H32N4O2 — CID 69092280
3-[3-cyano-4,6-dimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolo[2,3-b]pyridin-2-yl]-N-methyl-N-(oxan-4-yl)prop-2-enamide (PubChem CID 69092280) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 3-[3-cyano-4,6-dimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolo[2,3-b]pyridin-2-yl]-N-methyl-N-(oxan-4-yl)prop-2-enamide.
| Compound Name | 3-[3-cyano-4,6-dimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolo[2,3-b]pyridin-2-yl]-N-methyl-N-(oxan-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 69092280 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 3-[3-cyano-4,6-dimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)pyrrolo[2,3-b]pyridin-2-yl]-N-methyl-N-(oxan-4-yl)prop-2-enamide |
| SMILES | Cc1cc(C)c2c(C#N)c(C=CC(=O)N(C)C3CCOCC3)n(C3CCCc4ccccc43)c2n1 |
| InChI | InChI=1S/C29H32N4O2/c1-19-17-20(2)31-29-28(19)24(18-30)26(11-12-27(34)32(3)22-13-15-35-16-14-22)33(29)25-10-6-8-21-7-4-5-9-23(21)25/h4-5,7,9,11-12,17,22,25H,6,8,10,13-16H2,1-3H3 |
| InChIKey | XPLUSWLBAFTANV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|