About (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride
(2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride (PubChem CID 69093033) has the molecular formula C13H15ClF2O4
and a molecular weight of 308.71 g/mol. Its IUPAC name is (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride |
| PubChem CID | 69093033 |
| Molecular Formula | C13H15ClF2O4 |
| Molecular Weight | 308.71 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@](O)(c1ccccc1)[C@@H]1CC(O)C(F)(F)C1 |
| InChI | InChI=1S/C13H14F2O4.ClH/c14-12(15)7-9(6-10(12)16)13(19,11(17)18)8-4-2-1-3-5-8;/h1-5,9-10,16,19H,6-7H2,(H,17,18);1H/t9-,10?,13+;/m1./s1 |
| InChIKey | XCBMYMNZIVLWNC-OHOUNCDSSA-N |
| XLogP | 1.79 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride?
The IUPAC name of (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride (CID 69093033) is (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride.
What is the SMILES notation for (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride?
The canonical SMILES for (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride is Cl.O=C(O)[C@](O)(c1ccccc1)[C@@H]1CC(O)C(F)(F)C1.
What is the InChIKey of (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride?
The InChIKey is XCBMYMNZIVLWNC-OHOUNCDSSA-N. The full InChI is InChI=1S/C13H14F2O4.ClH/c14-12(15)7-9(6-10(12)16)13(19,11(17)18)8-4-2-1-3-5-8;/h1-5,9-10,16,19H,6-7H2,(H,17,18);1H/t9-,10?,13+;/m1./s1.
What are the key properties of (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride?
(2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride has a molecular weight of 308.71 g/mol, XLogP of 1.79, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1R)-3,3-difluoro-4-hydroxycyclopentyl]-2-hydroxy-2-phenylacetic acid;hydrochloride is sourced from PubChem (CID 69093033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).