C15H13ClFN5 — CID 69093900
4-(4-chloro-3-fluorophenyl)-5-methyl-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine (PubChem CID 69093900) has the molecular formula C15H13ClFN5 and a molecular weight of 317.76 g/mol. Its IUPAC name is 4-(4-chloro-3-fluorophenyl)-5-methyl-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | 4-(4-chloro-3-fluorophenyl)-5-methyl-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 69093900 |
| Molecular Formula | C15H13ClFN5 |
| Molecular Weight | 317.76 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 4-(4-chloro-3-fluorophenyl)-5-methyl-N-(1-methylpyrazol-4-yl)pyrimidin-2-amine |
| SMILES | Cc1cnc(Nc2cnn(C)c2)nc1-c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C15H13ClFN5/c1-9-6-18-15(20-11-7-19-22(2)8-11)21-14(9)10-3-4-12(16)13(17)5-10/h3-8H,1-2H3,(H,18,20,21) |
| InChIKey | QFJVHXPJTVNICR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |