C17H15BrN2O5 — CID 6909519
2-[4-[(E)-[[2-(3-bromophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 6909519) has the molecular formula C17H15BrN2O5 and a molecular weight of 407.22 g/mol. Its IUPAC name is 2-[4-[(E)-[[2-(3-bromophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[[2-(3-bromophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6909519 |
| Molecular Formula | C17H15BrN2O5 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-[4-[(E)-[[2-(3-bromophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=N/NC(=O)COc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C17H15BrN2O5/c18-13-2-1-3-15(8-13)24-10-16(21)20-19-9-12-4-6-14(7-5-12)25-11-17(22)23/h1-9H,10-11H2,(H,20,21)(H,22,23)/b19-9+ |
| InChIKey | WFQFTSMCNJDBAC-DJKKODMXSA-N |
| XLogP | 2.44 |
| TPSA | 97.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|