2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid

C11H11NO4 — CID 69095676

IUPAC2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid
SMILESCc1ccc2oc(=O)n(CC(=O)O)c2c1C
InChIInChI=1S/C11H11NO4/c1-6-3-4-8-10(7(6)2)12(5-9(13)14)11(15)16-8/h3-4H,5H2,1-2H3,(H,13,14)
InChIKeyXVKLDRPSYPCPER-UHFFFAOYSA-N
MW221.21 g/mol
LogP1.30
Rot. Bonds2

About 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid

2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid (PubChem CID 69095676) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid
PubChem CID69095676
Molecular FormulaC11H11NO4
Molecular Weight221.21 g/mol
Exact Mass221.07
IUPAC Name2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid
SMILESCc1ccc2oc(=O)n(CC(=O)O)c2c1C
InChIInChI=1S/C11H11NO4/c1-6-3-4-8-10(7(6)2)12(5-9(13)14)11(15)16-8/h3-4H,5H2,1-2H3,(H,13,14)
InChIKeyXVKLDRPSYPCPER-UHFFFAOYSA-N
XLogP1.30
TPSA72.44 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.21
LogP ≤ 51.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid?
The IUPAC name of 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid (CID 69095676) is 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid.
What is the SMILES notation for 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid?
The canonical SMILES for 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid is Cc1ccc2oc(=O)n(CC(=O)O)c2c1C.
What is the InChIKey of 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid?
The InChIKey is XVKLDRPSYPCPER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-6-3-4-8-10(7(6)2)12(5-9(13)14)11(15)16-8/h3-4H,5H2,1-2H3,(H,13,14).
What are the key properties of 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid?
2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid has a molecular weight of 221.21 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-2-oxo-1,3-benzoxazol-3-yl)acetic acid is sourced from PubChem (CID 69095676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).