C8H10FNO2 — CID 69095911
1-ethyl-2-(fluoromethyl)-5-hydroxypyridin-4-one (PubChem CID 69095911) has the molecular formula C8H10FNO2 and a molecular weight of 171.17 g/mol. Its IUPAC name is 1-ethyl-2-(fluoromethyl)-5-hydroxypyridin-4-one.
| Compound Name | 1-ethyl-2-(fluoromethyl)-5-hydroxypyridin-4-one |
|---|---|
| PubChem CID | 69095911 |
| Molecular Formula | C8H10FNO2 |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 1-ethyl-2-(fluoromethyl)-5-hydroxypyridin-4-one |
| SMILES | CCn1cc(O)c(=O)cc1CF |
| InChI | InChI=1S/C8H10FNO2/c1-2-10-5-8(12)7(11)3-6(10)4-9/h3,5,12H,2,4H2,1H3 |
| InChIKey | HAWJCRHXBRALBM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |