C14H17F3N2O — CID 69096673
(3S,5S,6R)-3-amino-1-ethyl-6-methyl-5-(2,3,5-trifluorophenyl)piperidin-2-one (PubChem CID 69096673) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is (3S,5S,6R)-3-amino-1-ethyl-6-methyl-5-(2,3,5-trifluorophenyl)piperidin-2-one.
| Compound Name | (3S,5S,6R)-3-amino-1-ethyl-6-methyl-5-(2,3,5-trifluorophenyl)piperidin-2-one |
|---|---|
| PubChem CID | 69096673 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (3S,5S,6R)-3-amino-1-ethyl-6-methyl-5-(2,3,5-trifluorophenyl)piperidin-2-one |
| SMILES | CCN1C(=O)[C@@H](N)C[C@@H](c2cc(F)cc(F)c2F)[C@H]1C |
| InChI | InChI=1S/C14H17F3N2O/c1-3-19-7(2)9(6-12(18)14(19)20)10-4-8(15)5-11(16)13(10)17/h4-5,7,9,12H,3,6,18H2,1-2H3/t7-,9-,12+/m1/s1 |
| InChIKey | PABAXXBIWMVASR-GMEUVTARSA-N |
| XLogP | 2.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|